* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | O-XYLENE-3,4,5,6-D4 (PHENYL-3,4,5,6-D4) |
| CAS: | 62367-40-2 |
| EnglishSynonyms: | DIMETHYLBENZENE-(RING-D4) ; O-XYLENE-3,4,5,6-D4 (PHENYL-3,4,5,6-D4) ; 1,2-DIMETHYLBENZENE-3,4,5,6-D4 ; O-XYLENE-D4 (RING-D4) |
| pro_mdlNumber: | MFCD01074184 |
| pro_acceptors: | 0 |
| pro_donors: | 0 |
| pro_smile: | [2H]c1c(c(c(c(c1[2H])C)C)[2H])[2H] |
| InChiKey: | InChIKey=null |
|
|
| MeltingPoint: | -25-(-23) DEG C(LIT) |
| Boiling_Point: | 143-145 DEG C(LIT) |
| Density: | DENSITY: 0.902 G/ML AT 25 DEG C |
| PhysicalProperty: | FLASHPOINT: 31 DEG C FLASHPOINT: 87.8 DEG F |
| Comments: | MASS SHIFT: M+4 RIDADR: UN 1307 3/PG 3 WGK: 2 |
| Information: | ISOTOPIC PURITY: 98 ATOM % D MW: 110.16 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.