* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-BUTOXYPROPANE-1,2-DIOL |
| CAS: | 624-52-2 |
| English Synonyms: | 3-BUTOXY-1,2-PROPANEDIOL ; 3-BUTOXYPROPANE-1,2-DIOL |
| MDL Number.: | MFCD00128132 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | CCCCOCC(CO)O |
| InChi: | InChI=1S/C7H16O3/c1-2-3-4-10-6-7(9)5-8/h7-9H,2-6H2,1H3 |
| InChiKey: | InChIKey=JCYHHICXJAGYEL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.