* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1'H-SPIRO[PIPERIDINE-4,3'-QUINOLIN]-2'(4'H)-ONE |
CAS: | 625829-51-8 |
English Synonyms: | 1'H-SPIRO[PIPERIDINE-4,3'-QUINOLIN]-2'(4'H)-ONE ; 3,4-BENZO-2,9-DIAZASPIRO[5,5]UNDECA-1-ONE |
MDL Number.: | MFCD11045515 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1ccc2c(c1)CC3(CCNCC3)C(=O)N2 |
InChi: | InChI=1S/C13H16N2O/c16-12-13(5-7-14-8-6-13)9-10-3-1-2-4-11(10)15-12/h1-4,14H,5-9H2,(H,15,16) |
InChiKey: | InChIKey=JOKQGBFPIZRFLU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.