* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (R)-3-(1-HYDROXYPROPYL)PHENOL |
CAS: | 625852-10-0 |
English Synonyms: | (R)-3-(1-HYDROXYPROPYL)PHENOL |
MDL Number.: | MFCD11100733 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | CC[C@H](c1cccc(c1)O)O |
InChi: | InChI=1S/C9H12O2/c1-2-9(11)7-4-3-5-8(10)6-7/h3-6,9-11H,2H2,1H3/t9-/m1/s1 |
InChiKey: | InChIKey=ZWEWBWNQZUJOIF-SECBINFHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.