* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-ETHENYL-4,5,6,7-TETRAHYDRO-1H-INDAZOLE |
CAS: | 62642-76-6 |
English Synonyms: | 1-ETHENYL-4,5,6,7-TETRAHYDRO-1H-INDAZOLE |
MDL Number.: | MFCD16619856 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | C=Cn1c2c(cn1)CCCC2 |
InChi: | InChI=1S/C9H12N2/c1-2-11-9-6-4-3-5-8(9)7-10-11/h2,7H,1,3-6H2 |
InChiKey: | InChIKey=KYASLQGQXRGFQD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.