* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Benzoic acid, 4-[(cyanomethyl)amino]- |
CAS: | 6275-82-7 |
English Synonyms: | BENZOIC ACID, 4-[(CYANOMETHYL)AMINO]- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(#N)CNC1=CC=C(C(=O)O)C=C1 |
InChi: | InChI=1S/C9H8N2O2/c10-5-6-11-8-3-1-7(2-4-8)9(12)13/h1-4,11H,6H2,(H,12,13) |
InChiKey: | InChIKey=BYJDWVPJZIZFCW-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.