Molecular Structure:
CAS No.:
62830-53-9
Product Name.:
CCD No.:CCD08001030
Formula:C14 H14 O3
MolWeight:230.262
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | Q 29 2-HYDROXY-3-ISOBUTYL-1,4-NAPHTHOQUINONE |
| CAS： | 62830-53-9 |
| English Synonyms： | Q 29 2-HYDROXY-3-ISOBUTYL-1,4-NAPHTHOQUINONE |
| MDL Number.： | MFCD00019577 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | CC(C)CC1=C(C(=O)c2ccccc2C1=O)O |
| InChi： | InChI=1S/C14H14O3/c1-8(2)7-11-12(15)9-5-3-4-6-10(9)13(16)14(11)17/h3-6,8,17H,7H2,1-2H3 |
| InChiKey： | InChIKey=UASBUFXONXNWEH-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
