* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | [1,1':4',1''-Terphenyl]-4,4''-dicarboxaldehyde |
CAS: | 62940-38-9 |
English Synonyms: | [1,1':4',1''-TERPHENYL]-4,4''-DICARBOXALDEHYDE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C1(=CC=C(C=C1)C=O)C1=CC=C(C=C1)C1=CC=C(C=C1)C=O |
InChi: | InChI=1S/C20H14O2/c21-13-15-1-5-17(6-2-15)19-9-11-20(12-10-19)18-7-3-16(14-22)4-8-18/h1-14H |
InChiKey: | InChIKey=YGHMZQVOFVDADV-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.