* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5,8-DIHYDRO-1,4-NAPHTHOQUINONE |
CAS: | 6295-28-9 |
English Synonyms: | 5,8-DIHYDRO-1,4-NAPHTHOQUINONE |
MDL Number.: | MFCD11111165 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | C1C=CCC2=C1C(=O)C=CC2=O |
InChi: | InChI=1S/C10H8O2/c11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-2,5-6H,3-4H2 |
InChiKey: | InChIKey=APSZOJQDLQCBRE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.