* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLUCUROLACTONE |
| CAS: | 63-29-6 |
| English Synonyms: | GLUCUROLACTONE |
| MDL Number.: | MFCD00078078 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | [C@H]1([C@@H]2[C@@H](C(C(=O)O2)O)O[C@H]1O)O |
| InChi: | InChI=1S/C6H8O6/c7-1-3-4(12-5(1)9)2(8)6(10)11-3/h1-5,7-9H/t1-,2?,3-,4-,5-/m1/s1 |
| InChiKey: | InChIKey=OGLCQHRZUSEXNB-UAPNVWQMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.