* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-METHYL-2,3,4,9-TETRAHYDRO-1H-CARBAZOLE |
CAS: | 6303-88-4 |
English Synonyms: | 9-METHYL-2,3,4,9-TETRAHYDRO-1H-CARBAZOLE |
MDL Number.: | MFCD00464645 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | Cn1c2ccccc2c3c1CCCC3 |
InChi: | InChI=1S/C13H15N/c1-14-12-8-4-2-6-10(12)11-7-3-5-9-13(11)14/h2,4,6,8H,3,5,7,9H2,1H3 |
InChiKey: | InChIKey=LXRZSWPAXJBXQM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.