* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-(4-PYRIDINYL)-2-BUTANONE |
CAS: | 6304-20-7 |
English Synonyms: | 1-(PYRIDIN-4-YL)BUTAN-2-ONE ; 1-(4-PYRIDINYL)-2-BUTANONE ; 2-BUTANONE, 1-(4-PYRIDINYL)- |
MDL Number.: | MFCD16659233 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCC(=O)Cc1ccncc1 |
InChi: | InChI=1S/C9H11NO/c1-2-9(11)7-8-3-5-10-6-4-8/h3-6H,2,7H2,1H3 |
InChiKey: | InChIKey=FBLVQXITSLUNLI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.