* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-NAPHTHALEN-2-YL-PROPAN-1-ONE |
| CAS: | 6315-96-4 |
| English Synonyms: | 1-NAPHTHALEN-2-YL-PROPAN-1-ONE |
| MDL Number.: | MFCD00228290 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CCC(=O)c1ccc2ccccc2c1 |
| InChi: | InChI=1S/C13H12O/c1-2-13(14)12-8-7-10-5-3-4-6-11(10)9-12/h3-9H,2H2,1H3 |
| InChiKey: | InChIKey=QLYPHTMKMPIJNG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.