* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3,5-DIHYDRO-1H-FURO[3,4-C]PYRROLE |
CAS: | 63156-08-1 |
English Synonyms: | 1H,3H,5H-FURO[3,4-C]PYRROLE ; 3,5-DIHYDRO-1H-FURO[3,4-C]PYRROLE |
MDL Number.: | MFCD12923736 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1c2c(c[nH]1)COC2 |
InChi: | InChI=1S/C6H7NO/c1-5-3-8-4-6(5)2-7-1/h1-2,7H,3-4H2 |
InChiKey: | InChIKey=GMKSSCADOOMELY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.