* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-(Dimethylamino)-acetamide |
CAS: | 6318-44-1 |
English Synonyms: | 2-(DIMETHYLAMINO)-ACETAMIDE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CN(CC(=O)N)C |
InChi: | InChI=1S/C4H10N2O/c1-6(2)3-4(5)7/h3H2,1-2H3,(H2,5,7) |
InChiKey: | InChIKey=WKJOQYHMXRVQDK-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.