* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5'-THIOADENOSINE |
CAS: | 63248-81-7 |
English Synonyms: | 5'-THIOADENOSINE |
MDL Number.: | MFCD12964299 |
H bond acceptor: | 8 |
H bond donor: | 3 |
Smile: | c1nc(c2c(n1)n(cn2)[C@H]3[C@@H]([C@@H]([C@H](O3)CS)O)O)N |
InChi: | InChI=1S/C10H13N5O3S/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(1-19)18-10/h2-4,6-7,10,16-17,19H,1H2,(H2,11,12,13)/t4-,6-,7-,10-/m1/s1 |
InChiKey: | InChIKey=HLJHWWUZHBUUAC-KQYNXXCUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.