* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | INDOLO[3,2-B]CARBAZOLE |
CAS: | 6336-32-9 ;241-55-4 |
English Synonyms: | INDOLO[3,2-B]CARBAZOLE |
MDL Number.: | MFCD09879263 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1ccc2=Nc3cc4=Nc5ccccc5-c4cc3=c2c1 |
InChi: | InChI=1S/C18H10N2/c1-3-7-15-11(5-1)13-9-14-12-6-2-4-8-16(12)20-18(14)10-17(13)19-15/h1-10H |
InChiKey: | InChIKey=HLYDAUPLQZMMTR-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.