* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ALEPTEROLIC ACID |
CAS: | 63399-38-2 |
English Synonyms: | ALEPTEROLIC ACID |
MDL Number.: | MFCD17214872 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | C/C(=C\C(=O)O)/CC[C@H]1C(=C)CC[C@@H]2[C@@]1(CC[C@@H](C2(C)C)O)C |
InChi: | InChI=1S/C20H32O3/c1-13(12-18(22)23)6-8-15-14(2)7-9-16-19(3,4)17(21)10-11-20(15,16)5/h12,15-17,21H,2,6-11H2,1,3-5H3,(H,22,23)/b13-12+/t15-,16-,17-,20+/m0/s1 |
InChiKey: | InChIKey=LNWOKEZJIRLIDO-ZJGHDVHGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.