* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-ETHOXY-9-ETHYL-9H-PURIN-6-AMINE |
CAS: | 634924-89-3 |
English Synonyms: | 8-ETHOXY-9-ETHYL-9H-PURIN-6-AMINE ; 9H-PURIN-6-AMINE, 8-ETHOXY-9-ETHYL- ; ANR 94 |
MDL Number.: | MFCD18086909 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CCn1c2c(c(ncn2)N)nc1OCC |
InChi: | InChI=1S/C9H13N5O/c1-3-14-8-6(7(10)11-5-12-8)13-9(14)15-4-2/h5H,3-4H2,1-2H3,(H2,10,11,12) |
InChiKey: | InChIKey=QUGDTMONBLMLLD-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.