* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-AMINO-3,4,6-TRICHLOROPHENOL |
| CAS: | 6358-15-2 |
| English Synonyms: | 2-AMINO-3,4,6-TRICHLOROPHENOL |
| MDL Number.: | MFCD06252434 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | c1c(c(c(c(c1Cl)Cl)N)O)Cl |
| InChi: | InChI=1S/C6H4Cl3NO/c7-2-1-3(8)6(11)5(10)4(2)9/h1,11H,10H2 |
| InChiKey: | InChIKey=QQDKXJSYZGJGKJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.