* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(2,4-DINITROANILINO)PHENOL |
CAS: | 6358-23-2 |
English Synonyms: | 2-(2,4-DINITROANILINO)PHENOL |
MDL Number.: | MFCD00156335 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | c1ccc(c(c1)Nc2ccc(cc2[N+](=O)[O-])[N+](=O)[O-])O |
InChi: | InChI=1S/C12H9N3O5/c16-12-4-2-1-3-10(12)13-9-6-5-8(14(17)18)7-11(9)15(19)20/h1-7,13,16H |
InChiKey: | InChIKey=IKBVHBLOMZBKQR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.