* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LITHIUM HIPPURATE |
| CAS: | 636-11-3 |
| English Synonyms: | LITHIUM HIPPURATE |
| MDL Number.: | MFCD00045899 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | [Li+].c1ccc(cc1)C(=O)NCC(=O)[O-] |
| InChi: | InChI=1S/C9H9NO3.Li/c11-8(12)6-10-9(13)7-4-2-1-3-5-7;/h1-5H,6H2,(H,10,13)(H,11,12);/q;+1/p-1 |
| InChiKey: | InChIKey=AICGKEYEKCPLSV-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.