* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-GLY-GLY-NVA-OH |
| CAS: | 63623-61-0 |
| English Synonyms: | Z-GLY-GLY-NVA-OH |
| MDL Number.: | MFCD00055802 |
| H bond acceptor: | 9 |
| H bond donor: | 4 |
| Smile: | CCC[C@@H](C(=O)O)NC(=O)CNC(=O)CNC(=O)OCc1ccccc1 |
| InChi: | InChI=1S/C17H23N3O6/c1-2-6-13(16(23)24)20-15(22)10-18-14(21)9-19-17(25)26-11-12-7-4-3-5-8-12/h3-5,7-8,13H,2,6,9-11H2,1H3,(H,18,21)(H,19,25)(H,20,22)(H,23,24)/t13-/m0/s1 |
| InChiKey: | InChIKey=JCRKZZNOFDAGDT-ZDUSSCGKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.