* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-AZASPIRO[5.6]DODEC-9-EN-1-ONE |
CAS: | 637742-79-1 |
English Synonyms: | 2-AZASPIRO[5.6]DODEC-9-EN-1-ONE |
MDL Number.: | MFCD13179423 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C1CC2(CCC=CCC2)C(=O)NC1 |
InChi: | InChI=1S/C11H17NO/c13-10-11(8-5-9-12-10)6-3-1-2-4-7-11/h1-2H,3-9H2,(H,12,13) |
InChiKey: | InChIKey=YOFZAEBYFKBTPJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.