* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SPIRO[BICYCLO[4.2.0]OCTA-1,3,5-TRIENE-7,2'-[1,3]-DIOXOLAN]-8-ONE |
CAS: | 6383-64-8 |
English Synonyms: | SPIRO[BICYCLO[4.2.0]OCTA-1,3,5-TRIENE-7,2'-[1,3]-DIOXOLAN]-8-ONE |
MDL Number.: | MFCD16876426 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1ccc2c(c1)C(=O)C23OCCO3 |
InChi: | InChI=1S/C10H8O3/c11-9-7-3-1-2-4-8(7)10(9)12-5-6-13-10/h1-4H,5-6H2 |
InChiKey: | InChIKey=UOQMBMQGBKMYTP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.