* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,3,4,6,7,8-HEXAHYDRO-2H-QUINOLIZINE |
CAS: | 6391-47-5 |
English Synonyms: | 1,3,4,6,7,8-HEXAHYDRO-2H-QUINOLIZINE ; 2,3,4,6,7,8-HEXAHYDRO-1H-QUINOLIZINE |
MDL Number.: | MFCD13178834 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | C1CCN2CCCC=C2C1 |
InChi: | InChI=1S/C9H15N/c1-3-7-10-8-4-2-6-9(10)5-1/h5H,1-4,6-8H2 |
InChiKey: | InChIKey=XRJWBIZYAUPOEA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.