* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-LYS-PHE-TYR-OH |
CAS: | 63958-93-0 |
English Synonyms: | L-LYS-PHE-TYR ; H-LYS-PHE-TYR-OH |
MDL Number.: | MFCD00081033 |
H bond acceptor: | 9 |
H bond donor: | 6 |
Smile: | c1ccc(cc1)C[C@@H](C(=O)N[C@@H](Cc2ccc(cc2)O)C(=O)O)NC(=O)[C@H](CCCCN)N |
InChi: | InChI=1S/C24H32N4O5/c25-13-5-4-8-19(26)22(30)27-20(14-16-6-2-1-3-7-16)23(31)28-21(24(32)33)15-17-9-11-18(29)12-10-17/h1-3,6-7,9-12,19-21,29H,4-5,8,13-15,25-26H2,(H,27,30)(H,28,31)(H,32,33)/t19-,20-,21-/m0/s1 |
InChiKey: | InChIKey=CNKBMTKICGGSCQ-ACRUOGEOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.