* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | AC-GLY-TRP-OH |
CAS: | 64013-28-1 |
English Synonyms: | AC-GLY-TRP-OH |
MDL Number.: | MFCD00137410 |
H bond acceptor: | 7 |
H bond donor: | 4 |
Smile: | CC(=O)NCC(=O)N[C@@H](Cc1c[nH]c2c1cccc2)C(=O)O |
InChi: | InChI=1S/C15H17N3O4/c1-9(19)16-8-14(20)18-13(15(21)22)6-10-7-17-12-5-3-2-4-11(10)12/h2-5,7,13,17H,6,8H2,1H3,(H,16,19)(H,18,20)(H,21,22)/t13-/m0/s1 |
InChiKey: | InChIKey=JMAZYXIVZMESFH-ZDUSSCGKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.