Molecular Structure:
CAS No.:
64028-90-6
Product Name.:
CCD No.:CCD00151638
Formula:C4 H8 Br2 O
MolWeight:231.914
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(12)
- Buyers(0)
- Spectrum(0)
- MSDS(1)
- Price(3)
|
|
| Product Name： | (S)-1,4-DIBROMO-2-BUTANOL |
| CAS： | 64028-90-6 |
| English Synonyms： | (S)-1,4-DIBROMO-BUTAN-2-OL ; (S)-1,4-DIBROMO-2-BUTANOL |
| MDL Number.： | MFCD00672882 |
| H bond acceptor： | 1 |
| H bond donor： | 1 |
| Smile： | C(CBr)[C@@H](CBr)O |
| InChi： | InChI=1S/C4H8Br2O/c5-2-1-4(7)3-6/h4,7H,1-3H2/t4-/m0/s1 |
| InChiKey： | InChIKey=PSSRAPMBSMSACN-BYPYZUCNSA-N |
|
|
| Boiling Point： | 114-115 DEG C/13 MMHG |
| Density： | DENSITY: 2.001 |
| Physical Property： | REFRACTIVE INDEX: 1.536 |
| Comments： | HAZARD: S24/25 TSCA: Y |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
