* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BOC-ALA-GLY-GLY-GLY-OH |
| CAS: | 64263-99-6 |
| English Synonyms: | BOC-ALA-GLY-GLY-GLY-OH |
| MDL Number.: | MFCD00133624 |
| H bond acceptor: | 11 |
| H bond donor: | 5 |
| Smile: | C[C@@H](C(=O)NCC(=O)NCC(=O)NCC(=O)O)NC(=O)OC(C)(C)C |
| InChi: | InChI=1S/C14H24N4O7/c1-8(18-13(24)25-14(2,3)4)12(23)17-6-10(20)15-5-9(19)16-7-11(21)22/h8H,5-7H2,1-4H3,(H,15,20)(H,16,19)(H,17,23)(H,18,24)(H,21,22)/t8-/m0/s1 |
| InChiKey: | InChIKey=CAPIMPNNGSBUKU-QMMMGPOBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.