* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GONYAUTOXIN IV |
| CAS: | 64296-26-0 |
| English Synonyms: | GONYAUTOXIN IV |
| MDL Number.: | MFCD00213820 |
| H bond acceptor: | 16 |
| H bond donor: | 8 |
| Smile: | C1[C@@H](C([C@@]23N1C(=N)N([C@H]([C@@H]2N=C(N3)N)COC(=O)N)O)(O)O)OS(=O)(=O)O |
| InChi: | InChI=1S/C10H17N7O9S/c11-6-14-5-3(2-25-8(13)18)17(21)7(12)16-1-4(26-27(22,23)24)10(19,20)9(5,16)15-6/h3-5,12,19-21H,1-2H2,(H2,13,18)(H3,11,14,15)(H,22,23,24)/t3-,4-,5-,9-/m0/s1 |
| InChiKey: | InChIKey=CETRDCWBMBILAL-LJRZAWCWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.