* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,2-ADAMANTANEDIAMINE |
CAS: | 28996-07-8 ;64343-35-7 |
English Synonyms: | 1,2-ADAMANTANEDIAMINE |
MDL Number.: | MFCD11519299 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | C1[C@@H]2C[C@@H]3C[C@H]1C[C@](C2)(C3N)N |
InChi: | InChI=1S/C10H18N2/c11-9-8-2-6-1-7(3-8)5-10(9,12)4-6/h6-9H,1-5,11-12H2/t6-,7+,8-,9?,10- |
InChiKey: | InChIKey=CCZNQFWUNRMXSN-MPDJXCSSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.