* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-METHOXY-1-METHYL-1H-INDOL-5-AMINE |
CAS: | 643962-27-0 |
English Synonyms: | 4-METHOXY-1-METHYL-1H-INDOL-5-AMINE |
MDL Number.: | MFCD12924525 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cn1ccc2c1ccc(c2OC)N |
InChi: | InChI=1S/C10H12N2O/c1-12-6-5-7-9(12)4-3-8(11)10(7)13-2/h3-6H,11H2,1-2H3 |
InChiKey: | InChIKey=TYZKWUXYBKSWTA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.