* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (-)-3,9-DIBROMOCAMPHOR |
CAS: | 64474-55-1 |
English Synonyms: | (-)-3,9-DIBROMOCAMPHOR |
MDL Number.: | MFCD00012267 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | C[C@]12CC[C@H](C1(C)CBr)C(C2=O)Br |
InChi: | InChI=1S/C10H14Br2O/c1-9-4-3-6(7(12)8(9)13)10(9,2)5-11/h6-7H,3-5H2,1-2H3/t6-,7?,9+,10?/m0/s1 |
InChiKey: | InChIKey=DCDNKSJBRIJYEC-KEQQSLRCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.