* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (2E)-2-METHYL-3-(1H-PYRROL-2-YL)-2-PROPENAL |
CAS: | 49616-04-8 ;64483-36-9 |
English Synonyms: | (2E)-2-METHYL-3-(1H-PYRROL-2-YL)-2-PROPENAL ; 2-METHYL-3-(1H-PYRROL-2-YL)-2-PROPENAL |
MDL Number.: | MFCD12923731 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C/C(=C\c1ccc[nH]1)/C=O |
InChi: | InChI=1S/C8H9NO/c1-7(6-10)5-8-3-2-4-9-8/h2-6,9H,1H3/b7-5+ |
InChiKey: | InChIKey=DAJNOZIFPCIITO-FNORWQNLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.