* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-HEXYL-4,5-DIMETHYL-1,3-DIOXOLANE |
CAS: | 6454-22-4 |
English Synonyms: | 2-HEXYL-4,5-DIMETHYL-1,3-DIOXOLANE |
MDL Number.: | MFCD21604305 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCCCCCC1OC(C(O1)C)C |
InChi: | InChI=1S/C11H22O2/c1-4-5-6-7-8-11-12-9(2)10(3)13-11/h9-11H,4-8H2,1-3H3 |
InChiKey: | InChIKey=MTNLKAOONWIMIT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.