* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-ETHYL-3,4-DIHYDRO-1H-PYRROLO[2,1-C][1,4]OXAZINE |
CAS: | 645410-04-4 |
English Synonyms: | 1H-PYRROLO[2,1-C][1,4]OXAZINE, 1-ETHYL-3,4-DIHYDRO- ; 1-ETHYL-3,4-DIHYDRO-1H-PYRROLO[2,1-C][1,4]OXAZINE |
MDL Number.: | MFCD12923937 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCC1c2cccn2CCO1 |
InChi: | InChI=1S/C9H13NO/c1-2-9-8-4-3-5-10(8)6-7-11-9/h3-5,9H,2,6-7H2,1H3 |
InChiKey: | InChIKey=AJTYMZRARFHNGF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.