* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,6-DIIODONAPHTHALENE |
CAS: | 64567-12-0 |
English Synonyms: | 1,6-DIIODONAPHTHALENE |
MDL Number.: | MFCD17012362 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | c1cc2cc(ccc2c(c1)I)I |
InChi: | InChI=1S/C10H6I2/c11-8-4-5-9-7(6-8)2-1-3-10(9)12/h1-6H |
InChiKey: | InChIKey=VVNYQGLSJNCRMM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.