* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | (R)-(-)-4-PENTEN-2-OL |
| CAS: | 64584-92-5 |
| English Synonyms: | (R)-(-)-PENTEN-2-OL ; (R)-2-HYDROXYPENT-4-ENE ; (R)-PENT-4-EN-2-OL ; (R)-(-)-2-HYDROXYPENT-4-ENE ; (R)-(-)-4-PENTEN-2-OL ; (2R)-PENT-4-EN-2-OL |
| MDL Number.: | MFCD03701536 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | C[C@H](CC=C)O |
| InChi: | InChI=1S/C5H10O/c1-3-4-5(2)6/h3,5-6H,1,4H2,2H3/t5-/m1/s1 |
| InChiKey: | InChIKey=ZHZCYWWNFQUZOR-RXMQYKEDSA-N |
|
|
| Boiling Point: | 115-116 DEG C(LIT) |
| Density: | DENSITY: 0.837 G/ML AT 25 DEG C(LIT) |
| Physical Property: | FLASHPOINT: 25 DEG C FLASHPOINT: 77 DEG F REFRACTIVE INDEX: N20/D 1.4240(LIT) |
| Comments: | OPTICAL ACTIVITY: [ALPHA]20/D -5.0 DEG, NEAT RIDADR: UN 1987 3/PG 3 UNSPSC: 12352100 WGK: 3 |
|
|
| Symbol: |
GHS02
|
| Signal word: | Warning |
| Hazard statements: | H226 |
| Risk Code: | R:10 |
| WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.