* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-NITROBENZO-2',6'-XYLIDIDE |
| CAS: | 64594-44-1 |
| English Synonyms: | 4-NITROBENZO-2',6'-XYLIDIDE |
| MDL Number.: | MFCD00034008 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | Cc1cccc(c1NC(=O)c2ccc(cc2)[N+](=O)[O-])C |
| InChi: | InChI=1S/C15H14N2O3/c1-10-4-3-5-11(2)14(10)16-15(18)12-6-8-13(9-7-12)17(19)20/h3-9H,1-2H3,(H,16,18) |
| InChiKey: | InChIKey=WBLNADQPUSRQIV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.