* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2,3-DIBROMO-1-(2,3,4,5,6-PENTAMETHYLPHENYL)-3-PHENYLPROPAN-1-ONE |
| CAS: | 646506-57-2 |
| English Synonyms: | 2,3-DIBROMO-1-(2,3,4,5,6-PENTAMETHYLPHENYL)-3-PHENYLPROPAN-1-ONE |
| MDL Number.: | MFCD00052406 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | Cc1c(c(c(c(c1C)C)C(=O)C(C(c2ccccc2)Br)Br)C)C |
| InChi: | InChI=1S/C20H22Br2O/c1-11-12(2)14(4)17(15(5)13(11)3)20(23)19(22)18(21)16-9-7-6-8-10-16/h6-10,18-19H,1-5H3 |
| InChiKey: | InChIKey=YORUIFVMXANPSV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.