* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ISOXAZOLO[5,4-C]PYRIDINE |
CAS: | 64761-69-9 |
English Synonyms: | [1,2]OXAZOLO[5,4-C]PYRIDINE ; ISOXAZOLO[5,4-C]PYRIDINE |
MDL Number.: | MFCD13175220 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1cncc2c1cno2 |
InChi: | InChI=1S/C6H4N2O/c1-2-7-4-6-5(1)3-8-9-6/h1-4H |
InChiKey: | InChIKey=WXTRHHSZKLAHHV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.