* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-(2'-FLUORO[1,1'-BIPHENYL]-4-YL)PROPAN-1-OL |
CAS: | 64820-95-7 |
English Synonyms: | 1-(2'-FLUORO[1,1'-BIPHENYL]-4-YL)PROPAN-1-OL |
MDL Number.: | MFCD00662442 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CCC(c1ccc(cc1)c2ccccc2F)O |
InChi: | InChI=1S/C15H15FO/c1-2-15(17)12-9-7-11(8-10-12)13-5-3-4-6-14(13)16/h3-10,15,17H,2H2,1H3 |
InChiKey: | InChIKey=QCPOHBUIIOWWEC-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.