* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-PHENOXY-1H-TETRAZOLE |
CAS: | 6489-09-4 |
English Synonyms: | 5-PHENOXY-1H-1,2,3,4-TETRAZOLE ; 5-PHENOXY-1H-TETRAZOLE |
MDL Number.: | MFCD00030425 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)Oc2[nH]nnn2 |
InChi: | InChI=1S/C7H6N4O/c1-2-4-6(5-3-1)12-7-8-10-11-9-7/h1-5H,(H,8,9,10,11) |
InChiKey: | InChIKey=UEHGAHXMHNQDIT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.