Molecular Structure:
CAS No.:
650615-75-1
Product Name.:
CCD No.:CCD00095770
Formula:C13 H17 Cl2 N5 O S
MolWeight:362.283
![1-([5-[(4,5-DICHLORO-1H-IMIDAZOL-1-YL)METHYL]-4-METHYL-4H-1,2,4-TRIAZOL-3-YL]THIO)-3,3-DIMETHYLBUTAN-2-ONE Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(2)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | 1-([5-[(4,5-DICHLORO-1H-IMIDAZOL-1-YL)METHYL]-4-METHYL-4H-1,2,4-TRIAZOL-3-YL]THIO)-3,3-DIMETHYLBUTAN-2-ONE |
| CAS： | 650615-75-1 |
| English Synonyms： | 1-([5-[(4,5-DICHLORO-1H-IMIDAZOL-1-YL)METHYL]-4-METHYL-4H-1,2,4-TRIAZOL-3-YL]THIO)-3,3-DIMETHYLBUTAN-2-ONE |
| MDL Number.： | MFCD00206676 |
| H bond acceptor： | 6 |
| H bond donor： | 0 |
| Smile： | CC(C)(C)C(=O)CSc1nnc(n1C)Cn2cnc(c2Cl)Cl |
| InChi： | InChI=1S/C13H17Cl2N5OS/c1-13(2,3)8(21)6-22-12-18-17-9(19(12)4)5-20-7-16-10(14)11(20)15/h7H,5-6H2,1-4H3 |
| InChiKey： | InChIKey=ZLKOKUHQDQHMIT-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
