* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-(1-BROMO-ETHYL)-3-CHLORO-BENZENE |
CAS: | 65130-47-4 |
English Synonyms: | 1-(1-BROMO-ETHYL)-3-CHLORO-BENZENE |
MDL Number.: | MFCD11103128 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC(c1cccc(c1)Cl)Br |
InChi: | InChI=1S/C8H8BrCl/c1-6(9)7-3-2-4-8(10)5-7/h2-6H,1H3 |
InChiKey: | InChIKey=GYMHOIORCMJXQL-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.