* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CYCLODECANE-1,3-DIONE |
CAS: | 6518-06-5 |
English Synonyms: | CYCLODECANE-1,3-DIONE |
MDL Number.: | MFCD17015335 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | C1CCCC(=O)CC(=O)CCC1 |
InChi: | InChI=1S/C10H16O2/c11-9-6-4-2-1-3-5-7-10(12)8-9/h1-8H2 |
InChiKey: | InChIKey=VIDCUPKHAMMBHZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.