* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Z-TRP-PHE-OH |
CAS: | 6521-49-9 |
English Synonyms: | Z-TRP-PHE-OH |
MDL Number.: | MFCD00136663 |
H bond acceptor: | 8 |
H bond donor: | 4 |
Smile: | c1ccc(cc1)C[C@@H](C(=O)O)NC(=O)[C@H](Cc2c[nH]c3c2cccc3)NC(=O)OCc4ccccc4 |
InChi: | InChI=1S/C28H27N3O5/c32-26(30-25(27(33)34)15-19-9-3-1-4-10-19)24(16-21-17-29-23-14-8-7-13-22(21)23)31-28(35)36-18-20-11-5-2-6-12-20/h1-14,17,24-25,29H,15-16,18H2,(H,30,32)(H,31,35)(H,33,34)/t24-,25-/m0/s1 |
InChiKey: | InChIKey=NRTMQKMHFPBQNP-DQEYMECFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.