* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5H,7H,8H-PYRANO[4,3-B]PYRIDINE |
CAS: | 65210-60-8 |
English Synonyms: | 5H-PYRANO[4,3-B]PYRIDINE, 7,8-DIHYDRO- ; 5H,7H,8H-PYRANO[4,3-B]PYRIDINE ; 7,8-DIHYDRO-5H-PYRANO[4,3-B]PYRIDINE |
MDL Number.: | MFCD13176063 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1cc2c(nc1)CCOC2 |
InChi: | InChI=1S/C8H9NO/c1-2-7-6-10-5-3-8(7)9-4-1/h1-2,4H,3,5-6H2 |
InChiKey: | InChIKey=OAOJNTGCUVEIEL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.