* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,2,4,5,6,7-HEXAHYDRO-3H-PYRAZOLO[3,4-C]PYRIDIN-3-ONE |
CAS: | 654666-65-6 |
English Synonyms: | 1H,2H,3H,4H,5H,6H,7H-PYRAZOLO[3,4-C]PYRIDIN-3-ONE ; 1,2,4,5,6,7-HEXAHYDRO-3H-PYRAZOLO[3,4-C]PYRIDIN-3-ONE |
MDL Number.: | MFCD13178728 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | C1CNCc2c1c(=O)[nH][nH]2 |
InChi: | InChI=1S/C6H9N3O/c10-6-4-1-2-7-3-5(4)8-9-6/h7H,1-3H2,(H2,8,9,10) |
InChiKey: | InChIKey=UPMMUUFLHUEUKP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.